Input interpretation
strontium nitrate
Chemical names and formulas
formula | Sr(NO_3)_2 Hill formula | N_2O_6Sr name | strontium nitrate IUPAC name | strontium dinitrate alternate names | strontium dinitrate | strontium(II) nitrate | strontium(II) nitrate(1:2) mass fractions | N (nitrogen) 13.2% | O (oxygen) 45.4% | Sr (strontium) 41.4%
Structure diagram
Structure diagram
Basic properties
molar mass | 211.6 g/mol phase | solid (at STP) melting point | 570 °C density | 2.113 g/cm^3
Units
Solid properties (at STP)
density | 2.113 g/cm^3
Units
Thermodynamic properties
specific heat capacity c_p | solid | 0.7083 J/(g K) molar heat capacity c_p | solid | 149.9 J/(mol K) specific free energy of formation Δ_fG° | solid | -3.686 kJ/g molar free energy of formation Δ_fG° | solid | -780 kJ/mol specific heat of formation Δ_fH° | solid | -4.622 kJ/g molar heat of formation Δ_fH° | solid | -978.2 kJ/mol molar heat of fusion | 44.6 kJ/mol | specific heat of fusion | 0.211 kJ/g | (at STP)
Chemical identifiers
([O-])[O-].[N+](=O)([O-])[O-].[Sr+2] InChI identifier | InChI=1/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2 RTECS number | WK9800000 MDL number | MFCD00011248](../image_source/239b637d01241ad18fdd930aebcb6df7.png)
CAS number | 10042-76-9 PubChem CID number | 24848 PubChem SID number | 24852272 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Sr+2] InChI identifier | InChI=1/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2 RTECS number | WK9800000 MDL number | MFCD00011248
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
Toxicity properties
RTECS classes | other
Ion equivalents
Sr^(2+) (strontium cation) | 1 (NO_3)^- (nitrate anion) | 2