Search

name of strontium hexaboride

Input interpretation

strontium hexaboride
strontium hexaboride

Chemical names and formulas

formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%
formula | SrB_6 Hill formula | B_6Sr name | strontium hexaboride mass fractions | B (boron) 42.5% | Sr (strontium) 57.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151
vertex count | 7 edge count | 8 Schultz index | 164 Wiener index | 23 Hosoya index | 25 Balaban index | 2.151

Basic properties

molar mass | 152.5 g/mol density | 3.39 g/cm^3
molar mass | 152.5 g/mol density | 3.39 g/cm^3

Units

Chemical identifiers

CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211
CAS number | 12046-54-7 PubChem CID number | 16212527 PubChem SID number | 24864614 SMILES identifier | [B-]1B2B1B3B2[B-]3.[Sr+2] InChI identifier | InChI=1/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 MDL number | MFCD01310211

Random Queries

H2SO4 + K2Cr2O7 + Na2S = H2O + K2SO4 + S + Na2SO4 + Cr2(SO4)3
freezing point of manganese(II) chloride tetrahydrate vs quartz
CAS number of calcium peroxide vs sodium borodeuteride
KOH + Zn(NO3)2 = KNO3 + Zn(OH)2
net ionic charge of tantalum(III) cation
electronegativity of hydrogen vs antimony
molar mass of manganese(II) perchlorate hexahydrate vs thorium telluride
IUPAC name of tetrasodium ethylenediaminetetraacetate
astatine(I) cation
Mohs hardness of iridium vs rhodium