Input interpretation
bis(pentafluorophenyl)methanol
Chemical names and formulas
formula | (C_6F_5)_2CHOH Hill formula | C_13H_2F_10O name | bis(pentafluorophenyl)methanol IUPAC name | bis(2, 3, 4, 5, 6-pentafluorophenyl)methanol alternate names | 2, 3, 4, 5, 6, 2', 3', 4', 5', 6'-decafluorodiphenylcarbinol | benzhydrol, 2, 2', 3, 3', 4, 4', 5, 5', 6, 6'-decafluoro- | bis(2, 3, 4, 5, 6-pentafluorophenyl)methanol mass fractions | C (carbon) 42.9% | F (fluorine) 52.2% | H (hydrogen) 0.554% | O (oxygen) 4.39%
Lewis structure
Draw the Lewis structure of bis(pentafluorophenyl)methanol. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 13 n_C, val + 10 n_F, val + 2 n_H, val + n_O, val = 130 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 13 n_C, full + 10 n_F, full + 2 n_H, full + n_O, full = 196 Subtracting these two numbers shows that 196 - 130 = 66 bonding electrons are needed. Each bond has two electrons, so in addition to the 27 bonds already present in the diagram add 6 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 6 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 364.14 g/mol phase | solid (at STP) melting point | 78.5 °C density | 1.883 g/cm^3
Units
Solid properties (at STP)
density | 1.883 g/cm^3
Units
Chemical identifiers
CAS number | 1766-76-3 Beilstein number | 2067248 PubChem CID number | 74485 PubChem SID number | 24851772 SMILES identifier | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C2=C(C(=C(C(=C2F)F)F)F)F)O InChI identifier | InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13, 24H MDL number | MFCD00000297
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0