Input interpretation
![benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]-](../image_source/d6ed021c4c9e3678b2978f73555eb528.png)
benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]-
Chemical names and formulas
![formula | CF_3C_6H_4OC_6H_4CHO Hill formula | C_14H_9F_3O_2 name | benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]- IUPAC name | 3-[3-(trifluoromethyl)phenoxy]benzaldehyde alternate names | 3-(3'-(trifluoromethyl)phenoxy)benzaldehyde | 3-(3-[trifluoromethyl]phenoxy)benzaldehyde | 3-(3'-trifluoromethyl)phenoxy)benzaldehyde | 3-[3-(trifluoromethyl)phenoxy]benzaldehyde | 3-(α, α, α-trifluoro-m-tolyloxy)benzaldehyde mass fractions | C (carbon) 63.2% | F (fluorine) 21.4% | H (hydrogen) 3.41% | O (oxygen) 12%](../image_source/506c788d85a7d9c281b829eb4fb63d42.png)
formula | CF_3C_6H_4OC_6H_4CHO Hill formula | C_14H_9F_3O_2 name | benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]- IUPAC name | 3-[3-(trifluoromethyl)phenoxy]benzaldehyde alternate names | 3-(3'-(trifluoromethyl)phenoxy)benzaldehyde | 3-(3-[trifluoromethyl]phenoxy)benzaldehyde | 3-(3'-trifluoromethyl)phenoxy)benzaldehyde | 3-[3-(trifluoromethyl)phenoxy]benzaldehyde | 3-(α, α, α-trifluoro-m-tolyloxy)benzaldehyde mass fractions | C (carbon) 63.2% | F (fluorine) 21.4% | H (hydrogen) 3.41% | O (oxygen) 12%
Lewis structure
![Draw the Lewis structure of benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]-. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 14 n_C, val + 3 n_F, val + 9 n_H, val + 2 n_O, val = 98 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 14 n_C, full + 3 n_F, full + 9 n_H, full + 2 n_O, full = 170 Subtracting these two numbers shows that 170 - 98 = 72 bonding electrons are needed. Each bond has two electrons, so in addition to the 29 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |](../image_source/21246d4dd6ab407e1e8a2eb0f2f83e30.png)
Draw the Lewis structure of benzaldehyde, 3-[3-(trifluoromethyl)phenoxy]-. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 14 n_C, val + 3 n_F, val + 9 n_H, val + 2 n_O, val = 98 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 14 n_C, full + 3 n_F, full + 9 n_H, full + 2 n_O, full = 170 Subtracting these two numbers shows that 170 - 98 = 72 bonding electrons are needed. Each bond has two electrons, so in addition to the 29 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 266.22 g/mol phase | liquid (at STP) boiling point | 130 °C (measured at 186.6 Pa) density | 1.284 g/cm^3
Units
Liquid properties (at STP)
density | 1.284 g/cm^3 refractive index | 1.538
Units
Chemical identifiers
CAS number | 78725-46-9 PubChem CID number | 522711 PubChem SID number | 24851689 SMILES identifier | C1=CC(=CC(=C1)OC2=CC=CC(=C2)C(F)(F)F)C=O InChI identifier | InChI=1/C14H9F3O2/c15-14(16, 17)11-4-2-6-13(8-11)19-12-5-1-3-10(7-12)9-18/h1-9H MDL number | MFCD00003356
Safety properties
flash point | 110 °C