Search

InChI identifier of heptanoic acid

Input interpretation

heptanoic acid | InChI identifier
heptanoic acid | InChI identifier

Result

InChI=1/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2, 1H3, (H, 8, 9)/f/h8H
InChI=1/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2, 1H3, (H, 8, 9)/f/h8H

Random Queries

sucrose vs β-D-fructopyranose
O2 + Fe = Fe2O2
H2SO4 + KMnO4 + CH3COCH3 = H2O + CO2 + K2SO4 + MnSO4 + CH3COOH
H2O + KNO2 + NaMnO4 = NaOH + MnO2 + KNO3
density of rhodium
IUPAC name of acetonitrile vs acetic acid
work function of sodium
molar mass of 2-chloro-6-methoxyphenylboronic acid vs 4-(trifluoromethoxy)phenylboronic acid
ion class of telluride anion
CAS number of 2-iodophenol