Input interpretation
yellow arsenic
Chemical names and formulas
formula | As_4 name | yellow arsenic alternate names | arsenic tetramer | arsenic yellow | crystalline cubic arsenic | non-metallic arsenic | tetraarsenic mass fractions | As (arsenic) 100%
Lewis structure
Draw the Lewis structure of yellow arsenic. Start by drawing the overall structure of the molecule: Count the total valence electrons of the arsenic (n_As, val = 5) atoms: 4 n_As, val = 20 Calculate the number of electrons needed to completely fill the valence shells for arsenic (n_As, full = 8): 4 n_As, full = 32 Subtracting these two numbers shows that 32 - 20 = 12 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 6 bonds and hence 12 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 20 - 12 = 8 electrons left to draw: Answer: | |
Basic properties
molar mass | 299.68638 g/mol phase | solid (at STP) density | 1.97 g/cm^3
Units
Solid properties (at STP)
density | 1.97 g/cm^3
Units
Thermodynamic properties
specific heat of formation Δ_fH° | solid | 0.04872 kJ/g molar heat of formation Δ_fH° | solid | 14.6 kJ/mol (at STP)
Chemical identifiers
![CAS number | 12187-08-5 PubChem CID number | 139279 PubChem SID number | 10505763 SMILES identifier | [As]12[As]3[As]1[As]23 InChI identifier | InChI=1S/As4/c1-2-3(1)4(1)2](../image_source/30be3e72428827b1e778bfbbf37b2d21.png)
CAS number | 12187-08-5 PubChem CID number | 139279 PubChem SID number | 10505763 SMILES identifier | [As]12[As]3[As]1[As]23 InChI identifier | InChI=1S/As4/c1-2-3(1)4(1)2