Search

InChI identifier of hypoiodous acid vs propionic acid

Input interpretation

hypoiodous acid propionic acid | InChI identifier
hypoiodous acid propionic acid | InChI identifier

Results

hypoiodous acid | InChI=1S/HIO/c1-2/h2H propionic acid | InChI=1/C3H6O2/c1-2-3(4)5/h2H2, 1H3, (H, 4, 5)/f/h4H
hypoiodous acid | InChI=1S/HIO/c1-2/h2H propionic acid | InChI=1/C3H6O2/c1-2-3(4)5/h2H2, 1H3, (H, 4, 5)/f/h4H

Random Queries

KOH + H2O2 + AgNO3 = H2O + O2 + KNO3 + Ag
nuclear radius of lithium vs sodium
zinc bromide
density of sodium periodate trihydrate
ion class of indium(I) cation vs fluoride anion
molar mass of platinum(IV) oxide
H2SO4 + H2O2 + KNO3 = H2O + O2 + K2SO4 + NO
chemical types of thulium(III) oxalate vs barium stannate
group of livermorium
alternate names of selenium trioxide