Input interpretation
![barium nitrate](../image_source/536482fbb46322ad16c2d3adb0d08f1e.png)
barium nitrate
Chemical names and formulas
![formula | Ba(NO_3)_2 Hill formula | BaN_2O_6 name | barium nitrate IUPAC name | barium(+2) cation dinitrate alternate names | barium(+2) cation dinitrate | barium dinitrate | barium(II) nitrate(1:2) | nitrobarite mass fractions | Ba (barium) 52.5% | N (nitrogen) 10.7% | O (oxygen) 36.7%](../image_source/8bbf567d0bbd9a90e4f925bbd883acf1.png)
formula | Ba(NO_3)_2 Hill formula | BaN_2O_6 name | barium nitrate IUPAC name | barium(+2) cation dinitrate alternate names | barium(+2) cation dinitrate | barium dinitrate | barium(II) nitrate(1:2) | nitrobarite mass fractions | Ba (barium) 52.5% | N (nitrogen) 10.7% | O (oxygen) 36.7%
Structure diagram
![Structure diagram](../image_source/354f50902e55cd82c67e29c5ebc8c5e2.png)
Structure diagram
Basic properties
![molar mass | 261.34 g/mol phase | solid (at STP) melting point | 592 °C density | 3.23 g/cm^3](../image_source/624239ede4c10e88ea07f2033174a26e.png)
molar mass | 261.34 g/mol phase | solid (at STP) melting point | 592 °C density | 3.23 g/cm^3
Units
Solid properties (at STP)
![density | 3.23 g/cm^3 refractive index | 1.5659](../image_source/a54dbaf8181486843fd057d3fb04104c.png)
density | 3.23 g/cm^3 refractive index | 1.5659
Units
Thermodynamic properties
![specific heat capacity c_p | solid | 0.5793 J/(g K) molar heat capacity c_p | solid | 151.4 J/(mol K) specific free energy of formation Δ_fG° | solid | -30.329 kJ/g molar free energy of formation Δ_fG° | solid | -7926 kJ/mol specific heat of formation Δ_fH° | solid | -3.781 kJ/g molar heat of formation Δ_fH° | solid | -988 kJ/mol molar heat of fusion | 24.7 kJ/mol | specific heat of fusion | 0.09451 kJ/g | (at STP)](../image_source/7ad3868df9fd8258dfa70448e9b1357c.png)
specific heat capacity c_p | solid | 0.5793 J/(g K) molar heat capacity c_p | solid | 151.4 J/(mol K) specific free energy of formation Δ_fG° | solid | -30.329 kJ/g molar free energy of formation Δ_fG° | solid | -7926 kJ/mol specific heat of formation Δ_fH° | solid | -3.781 kJ/g molar heat of formation Δ_fH° | solid | -988 kJ/mol molar heat of fusion | 24.7 kJ/mol | specific heat of fusion | 0.09451 kJ/g | (at STP)
Chemical identifiers
![CAS number | 10022-31-8 PubChem CID number | 24798 PubChem SID number | 24852115 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ba+2] InChI identifier | InChI=1/Ba.2NO3/c;2*2-1(3)4/q+2;2*-1 RTECS number | CQ9625000 MDL number | MFCD00003442](../image_source/418102d17ebb4391c9c2e3456e665538.png)
CAS number | 10022-31-8 PubChem CID number | 24798 PubChem SID number | 24852115 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ba+2] InChI identifier | InChI=1/Ba.2NO3/c;2*2-1(3)4/q+2;2*-1 RTECS number | CQ9625000 MDL number | MFCD00003442
NFPA label
![NFPA label](../image_source/101e733dd5bc41a6a6392fd2774b67c5.png)
NFPA label
![NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent](../image_source/007be2aa9fb0e50b17775aa61177542d.png)
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
Toxicity properties
![RTECS classes | human data | primary irritant](../image_source/d24c6002a9433eebff3d2e3e66c9ee86.png)
RTECS classes | human data | primary irritant
Ion equivalents
![Ba^(2+) (barium cation) | 1 (NO_3)^- (nitrate anion) | 2](../image_source/35eefe881d8843faa4fcc48f0817c5a6.png)
Ba^(2+) (barium cation) | 1 (NO_3)^- (nitrate anion) | 2