Input interpretation
chromium trioxide
Chemical names and formulas
formula | CrO_3 name | chromium trioxide IUPAC name | trioxochromium alternate names | chromic anhydride | chromium oxide | chromium(VI) oxide | trioxochromium mass fractions | Cr (chromium) 52% | O (oxygen) 48%
Structure diagram
Structure diagram
vertex count | 4 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
Basic properties
molar mass | 99.993 g/mol phase | solid (at STP) melting point | 196 °C solubility in water | very soluble
Units
Thermodynamic properties
specific heat capacity c_p | gas | 0.56 J/(g K) molar heat capacity c_p | gas | 56 J/(mol K) specific free energy of formation Δ_fG° | solid | -5.02 kJ/g molar free energy of formation Δ_fG° | solid | -502 kJ/mol specific heat of formation Δ_fH° | gas | -2.929 kJ/g molar heat of formation Δ_fH° | gas | -292.9 kJ/mol specific entropy S° | solid | 0.72 J/(g K) molar entropy S° | solid | 72 J/(mol K) molar heat of fusion | 14.2 kJ/mol | specific heat of fusion | 0.142 kJ/g | (at STP)
Chemical identifiers
=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952](../image_source/a13e1fe7007a15792358668353c2dba1.png)
CAS number | 1333-82-0 PubChem CID number | 14915 SMILES identifier | O=[Cr](=O)=O InChI identifier | InChI=1/Cr.3O/rCrO3/c2-1(3)4 RTECS number | GB6650000 MDL number | MFCD00010952
NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 1 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent
Toxicity properties
odor | odorless lethal dosage | 80 mg/kg (oral dose for rats)
probable lethal dose for man | 30 mL (milliliters) RTECS classes | tumorigen | mutagen | reproductive effector | human data