Search

potassium hexaiodorhenate(IV) vs haloprogin

Input interpretation

potassium hexaiodorhenate(IV) | haloprogin
potassium hexaiodorhenate(IV) | haloprogin

Chemical names and formulas

 | potassium hexaiodorhenate(IV) | haloprogin formula | K_2ReI_6 | C_9H_4Cl_3IO Hill formula | I_6K_2Re | C_9H_4Cl_3IO name | potassium hexaiodorhenate(IV) | haloprogin IUPAC name | dipotassium hexaiodorhenium | 1, 2, 4-trichloro-5-(3-iodoprop-2-ynoxy)benzene alternate names | dipotassium hexaiodorhenium | 3-iodo-2-propynyl-2, 4, 5-trichlorophenyl ether | halotex | mycanden | mycilan mass fractions | I (iodine) 74.2% | K (potassium) 7.62% | Re (rhenium) 18.2% | C (carbon) 29.9% | Cl (chlorine) 29.4% | H (hydrogen) 1.12% | I (iodine) 35.1% | O (oxygen) 4.43%
| potassium hexaiodorhenate(IV) | haloprogin formula | K_2ReI_6 | C_9H_4Cl_3IO Hill formula | I_6K_2Re | C_9H_4Cl_3IO name | potassium hexaiodorhenate(IV) | haloprogin IUPAC name | dipotassium hexaiodorhenium | 1, 2, 4-trichloro-5-(3-iodoprop-2-ynoxy)benzene alternate names | dipotassium hexaiodorhenium | 3-iodo-2-propynyl-2, 4, 5-trichlorophenyl ether | halotex | mycanden | mycilan mass fractions | I (iodine) 74.2% | K (potassium) 7.62% | Re (rhenium) 18.2% | C (carbon) 29.9% | Cl (chlorine) 29.4% | H (hydrogen) 1.12% | I (iodine) 35.1% | O (oxygen) 4.43%

Structure diagrams

  | potassium hexaiodorhenate(IV) | haloprogin vertex count | 9 | 14 edge count | 6 | 14 Schultz index | 144 | 1304 Wiener index | 36 | 329 Hosoya index | 7 | 583 Balaban index | 4.431 | 2.295
| potassium hexaiodorhenate(IV) | haloprogin vertex count | 9 | 14 edge count | 6 | 14 Schultz index | 144 | 1304 Wiener index | 36 | 329 Hosoya index | 7 | 583 Balaban index | 4.431 | 2.295

3D structure

3D structure
3D structure

Basic properties

 | potassium hexaiodorhenate(IV) | haloprogin molar mass | 1025.83 g/mol | 361.4 g/mol phase | | solid (at STP) melting point | | 114 °C solubility in water | | insoluble
| potassium hexaiodorhenate(IV) | haloprogin molar mass | 1025.83 g/mol | 361.4 g/mol phase | | solid (at STP) melting point | | 114 °C solubility in water | | insoluble

Units

Hydrophobicity and permeability properties

 | haloprogin experimental LogP hydrophobicity | 5.3 predicted LogP hydrophobicity | 4.69 predicted LogS | -4.78
| haloprogin experimental LogP hydrophobicity | 5.3 predicted LogP hydrophobicity | 4.69 predicted LogS | -4.78

Thermodynamic properties

 | haloprogin molar heat of vaporization | 61.7 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.171 kJ/g (kilojoules per gram)
| haloprogin molar heat of vaporization | 61.7 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.171 kJ/g (kilojoules per gram)

Solid properties

 | haloprogin vapor pressure | 5×10^-6 mmHg
| haloprogin vapor pressure | 5×10^-6 mmHg

Units

Chemical identifiers

 | potassium hexaiodorhenate(IV) | haloprogin CAS number | 19710-22-6 | 777-11-7 Beilstein number | | 1976771 PubChem CID number | 16217292 | 3561 PubChem SID number | 24880771 | 7847405 SMILES identifier | [K+].[K+].I[Re-2](I)(I)(I)(I)I | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC#CI InChI identifier | InChI=1/6HI.2K.Re/h6*1H;;;/q;;;;;;2*+1;+4/p-6/f6I.2K.Re/h6*1h;;;/q6*-1;3m/rI6Re.2K/c1-7(2, 3, 4, 5)6;;/q-2;2*+1 | InChI=1/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H, 3H2 InChI key | | CTETYYAZBPJBHE-UHFFFAOYAB EU number | | 212-286-6 RTECS number | | KO1225000 NSC number | | 100071 MDL number | MFCD04039937 |
| potassium hexaiodorhenate(IV) | haloprogin CAS number | 19710-22-6 | 777-11-7 Beilstein number | | 1976771 PubChem CID number | 16217292 | 3561 PubChem SID number | 24880771 | 7847405 SMILES identifier | [K+].[K+].I[Re-2](I)(I)(I)(I)I | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC#CI InChI identifier | InChI=1/6HI.2K.Re/h6*1H;;;/q;;;;;;2*+1;+4/p-6/f6I.2K.Re/h6*1h;;;/q6*-1;3m/rI6Re.2K/c1-7(2, 3, 4, 5)6;;/q-2;2*+1 | InChI=1/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H, 3H2 InChI key | | CTETYYAZBPJBHE-UHFFFAOYAB EU number | | 212-286-6 RTECS number | | KO1225000 NSC number | | 100071 MDL number | MFCD04039937 |