Input interpretation
3-aminoisobutyric acid
Chemical names and formulas
formula | C_4H_9NO_2 name | 3-aminoisobutyric acid IUPAC name | (2S)-3-azaniumyl-2-methyl-propanoate alternate names | 2-methyl-B-alanine | DL-beta-aminoisobutyric acid mass fractions | C (carbon) 46.6% | H (hydrogen) 8.8% | N (nitrogen) 13.6% | O (oxygen) 31%
Lewis structure
Draw the Lewis structure of 3-aminoisobutyric acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 4 n_C, val + 9 n_H, val + n_N, val + 2 n_O, val = 42 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 4 n_C, full + 9 n_H, full + n_N, full + 2 n_O, full = 74 Subtracting these two numbers shows that 74 - 42 = 32 bonding electrons are needed. Each bond has two electrons, so in addition to the 15 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: To fully fill its valence shell, nitrogen will donate one of its electrons, allowing it to form four bonds (atoms on period 2 cannot have an expanded valence shell). Fill in the 1 bond by pairing electrons between adjacent highlighted atoms, noting the formal charges of the atoms. Double bonding carbon to the other highlighted oxygen atom would result in an equivalent molecule: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 103.12 g/mol phase | liquid (at STP) boiling point | 224 °C solubility in water | very soluble
Units
Liquid properties (at STP)
vapor pressure | 0.04 mmHg (at 25 °C)
Units
Thermodynamic properties
molar heat of vaporization | 50.7 kJ/mol specific heat of vaporization | 0.492 kJ/g (at STP)
Chemical identifiers
![CAS number | 10569-72-9 Beilstein number | 1720958 PubChem CID number | 6971062 SMILES identifier | CC(C[NH3+])C(=O)[O-] InChI identifier | InChI=1/C4H9NO2/c1-3(2-5)4(6)7/h3H, 2, 5H2, 1H3, (H, 6, 7)/t3-/m0/s1/f/h5H EU number | 234-154-7](../image_source/5b6dcf9d741d9a3ce7abf0ef4b1a3ad2.png)
CAS number | 10569-72-9 Beilstein number | 1720958 PubChem CID number | 6971062 SMILES identifier | CC(C[NH3+])C(=O)[O-] InChI identifier | InChI=1/C4H9NO2/c1-3(2-5)4(6)7/h3H, 2, 5H2, 1H3, (H, 6, 7)/t3-/m0/s1/f/h5H EU number | 234-154-7
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 89 °C