Input interpretation
nickel(II) nitrate
Chemical names and formulas
formula | Ni(NO_3)_2 Hill formula | N_2NiO_6 name | nickel(II) nitrate IUPAC name | nickel(+2) dinitrate alternate names | nickel(2+) nitrate | nickel bis(nitrate) | nickel dinitrate | nickelous nitrate | nitric acid, nickel(II) salt mass fractions | N (nitrogen) 15.3% | Ni (nickel) 32.1% | O (oxygen) 52.5%
Structure diagram
Structure diagram
Basic properties
molar mass | 182.7 g/mol phase | solid (at STP) melting point | 57 °C boiling point | 137 °C density | 1.77 g/cm^3
Units
Solid properties (at STP)
density | 1.77 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 0.15 kJ/mol specific heat of fusion | 8.21×10^-4 kJ/g (at STP)
Chemical identifiers
([O-])[O-].[N+](=O)([O-])[O-].[Ni+2] InChI identifier | InChI=1/2NO3.Ni/c2*2-1(3)4;/q2*-1;+2 EU number | 238-076-4 Gmelin number | 7760 RTECS number | QR7200000](../image_source/3b5dc95b7a228aea1f2690a7d938692a.png)
CAS number | 13138-45-9 PubChem CID number | 25736 SMILES identifier | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ni+2] InChI identifier | InChI=1/2NO3.Ni/c2*2-1(3)4;/q2*-1;+2 EU number | 238-076-4 Gmelin number | 7760 RTECS number | QR7200000
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0 NFPA hazards | oxidizing agent
Toxicity properties
RTECS classes | mutagen | reproductive effector
Ion equivalents
Ni^(2+) (nickel(II) cation) | 1 (NO_3)^- (nitrate anion) | 2