Input interpretation
calcium oxalate
Chemical names and formulas
formula | CaC_2O_4 Hill formula | C_2CaO_4 name | calcium oxalate alternate names | calcium ethanedioate mass fractions | C (carbon) 18.8% | Ca (calcium) 31.3% | O (oxygen) 50%
Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
Basic properties
molar mass | 128.1 g/mol density | 2.2 g/cm^3
Units
Thermodynamic properties
specific heat of formation Δ_fH° | solid | -10.62 kJ/g molar heat of formation Δ_fH° | solid | -1361 kJ/mol (at STP)
Chemical identifiers
![CAS number | 563-72-4 PubChem CID number | 16212978 PubChem SID number | 24869101 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Ca+2] InChI identifier | InChI=1/C2H2O4.Ca/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Ca/q-2;m MDL number | MFCD00012474](../image_source/5be3d799e7cc1e29b2c6a12340b623a0.png)
CAS number | 563-72-4 PubChem CID number | 16212978 PubChem SID number | 24869101 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Ca+2] InChI identifier | InChI=1/C2H2O4.Ca/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Ca/q-2;m MDL number | MFCD00012474
Ion equivalents
Ca^(2+) (calcium cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1