Search

SMILES identifier of arsenic pentafluoride vs 3-chloro-2,4,5-trifluorobenzoic acid

Input interpretation

arsenic pentafluoride 3-chloro-2, 4, 5-trifluorobenzoic acid | SMILES identifier
arsenic pentafluoride 3-chloro-2, 4, 5-trifluorobenzoic acid | SMILES identifier

Results

arsenic pentafluoride | F[As](F)(F)(F)F 3-chloro-2, 4, 5-trifluorobenzoic acid | C1=C(C(=C(C(=C1F)F)Cl)F)C(=O)O
arsenic pentafluoride | F[As](F)(F)(F)F 3-chloro-2, 4, 5-trifluorobenzoic acid | C1=C(C(=C(C(=C1F)F)Cl)F)C(=O)O

Random Queries

H2O + Cl2 + Sb2O3 = HCl + H3SbO4
formula of metaschoderite vs metavanmeersscheite
transition metals ion
isotopes of copper
molecular mass of silver
name of neodymium(III) cation
ion class of nitrogen(I) cation vs bismuthide(3-) anion
H2O2 + HI = H2O + I2
cubic centimeter diborane
HNO3 + V = H2O + NO2 + V2O5