hybridization of dimethyl(4R,5 R)-1,3,2-dioxathiolane-4,5-dicarboxylate 2,2-dioxide

dimethyl(4R, 5 R)-1, 3, 2-dioxathiolane-4, 5-dicarboxylate 2, 2-dioxide | orbital hybridization

First draw the structure diagram for dimethyl(4R, 5 R)-1, 3, 2-dioxathiolane-4, 5-dicarboxylate 2, 2-dioxide, and for every non-hydrogen atom, count the σ-bonds. Note that double and triple bonds consist of one σ-bond together with one or two π-bonds: Identify those atoms with lone pairs: Find the steric number by adding the lone pair count to the number of σ-bonds: Consult the following chart to determine the hybridization from the steric number: steric number | hybridization 2 | sp 3 | sp^2 4 | sp^3 5 | dsp^3 6 | d^2sp^3 7 | d^3sp^3 Assign the provisional hybridization based on the table: Next identify any sp^3 atoms with lone pair electrons which can participate in a conjugated π-bond system. These atoms can lower their energy by placing a lone pair in a unhybridized p orbital to maximize overlap with the neighboring π-bonds. Note that halogens and elements from the third period and below do not engage in bond conjugation, except in the case of aromaticity: Adjust the provisional hybridizations to arrive at the result: Answer: | |

molar mass | 238.2 g/mol formula | (C_6H_6O_8S)^2- empirical formula | C_6O_8S_H_6 SMILES identifier | C[C@]1(C(=O)[O-])[C@](C)(C(=O)[O-])OS(=O)(=O)O1 InChI identifier | InChI=1/C6H8O8S/c1-5(3(7)8)6(2, 4(9)10)14-15(11, 12)13-5/h1-2H3, (H, 7, 8)(H, 9, 10)/p-2/t5-, 6-/m0/s1/fC6H6O8S/q-2 InChI key | UGGQTNASYHYLGW-WDSKDSINSA-L