Search

InChI identifier of sodium chlorate vs lithium dodecyl sulfate

Input interpretation

sodium chlorate lithium dodecyl sulfate | InChI identifier
sodium chlorate lithium dodecyl sulfate | InChI identifier

Results

sodium chlorate | InChI=1/ClHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Na/q-1;m lithium dodecyl sulfate | InChI=1/C12H26O4S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13, 14)15;/h2-12H2, 1H3, (H, 13, 14, 15);/q;+1/p-1/fC12H25O4S.Li/q-1;m
sodium chlorate | InChI=1/ClHO3.Na/c2-1(3)4;/h(H, 2, 3, 4);/q;+1/p-1/fClO3.Na/q-1;m lithium dodecyl sulfate | InChI=1/C12H26O4S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13, 14)15;/h2-12H2, 1H3, (H, 13, 14, 15);/q;+1/p-1/fC12H25O4S.Li/q-1;m

Random Queries

crystal system of urea vs guanine
mercury(II) cation vs gold(III) cation
IUPAC name of bromoform
decomposition point of selenious acid
HNO3 + Cs = H2O + N2O + CsNO3
total number of electrons of alkali metal ions
serum osmolarity
Mg + P = Mg3P
molar mass of amineptine
CAS number of antimony trioxide vs selenium tetrabromide