Search

name of ferrous oxalate

Input interpretation

ferrous oxalate
ferrous oxalate

Chemical names and formulas

formula | C_2FeO_4 name | ferrous oxalate IUPAC name | iron(+2) cation; oxalate alternate names | iron, [ethanedioato(2-)-O, O']- | iron(II) oxalate | iron protoxalate | oxalic acid, iron(2+) salt mass fractions | C (carbon) 16.7% | Fe (iron) 38.8% | O (oxygen) 44.5%
formula | C_2FeO_4 name | ferrous oxalate IUPAC name | iron(+2) cation; oxalate alternate names | iron, [ethanedioato(2-)-O, O']- | iron(II) oxalate | iron protoxalate | oxalic acid, iron(2+) salt mass fractions | C (carbon) 16.7% | Fe (iron) 38.8% | O (oxygen) 44.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993

Basic properties

molar mass | 143.86 g/mol density | 2.3 g/cm^3 solubility in water | slightly soluble
molar mass | 143.86 g/mol density | 2.3 g/cm^3 solubility in water | slightly soluble

Units

Chemical identifiers

CAS number | 516-03-0 PubChem CID number | 10589 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Fe+2] InChI identifier | InChI=1/C2H2O4.Fe/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Fe/q-2;m EU number | 208-217-4 Gmelin number | 48411
CAS number | 516-03-0 PubChem CID number | 10589 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Fe+2] InChI identifier | InChI=1/C2H2O4.Fe/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Fe/q-2;m EU number | 208-217-4 Gmelin number | 48411