Search

InChI identifier aurothioglucose

Input interpretation

aurothioglucose | InChI identifier
aurothioglucose | InChI identifier

Result

InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m
InChI=1/C6H12O5S.Au/c7-1-2-3(8)4(9)5(10)6(12)11-2;/h2-10, 12H, 1H2;/q;+1/p-1/t2-, 3-, 4+, 5-, 6-;/m1./s1/fC6H11O5S.Au/h12h;/q-1;m

Random Queries

structure diagram of rhodium(I) cation vs tetrafluoroborate anion
formula of alumoklyuchevskite vs chessexite
alternate names of 2-acrylamidoglycolic acid monohydrate
( hydrosulfide anion)
vanadium vs krypton vs copper vs zinc
net ionic charge of chlorine(V) cation vs iodide anion
molar mass of activated charcoal vs cyclo-hexasulfur
ion class of hydrogen sulfate anion vs hydrogen oxalate anion
turn into a comic an image of chromdravite
formula of copper(II) arsenate