Search

3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid

Input interpretation

3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid
3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid

Basic properties

molar mass | 405.7 g/mol formula | C_18H_14BrClN_2O_2 empirical formula | Br_C_18N_2O_2Cl_H_14 SMILES identifier | C1=C(C=CC(=C1)Br)C2=NN(C=C2CCC(=O)O)C3=CC=C(C=C3)Cl InChI identifier | InChI=1/C18H14BrClN2O2/c19-14-4-1-12(2-5-14)18-13(3-10-17(23)24)11-22(21-18)16-8-6-15(20)7-9-16/h1-2, 4-9, 11H, 3, 10H2, (H, 23, 24)/f/h23H InChI key | ZCBWGEKVGZXGBI-UHFFFAOYSA-N
molar mass | 405.7 g/mol formula | C_18H_14BrClN_2O_2 empirical formula | Br_C_18N_2O_2Cl_H_14 SMILES identifier | C1=C(C=CC(=C1)Br)C2=NN(C=C2CCC(=O)O)C3=CC=C(C=C3)Cl InChI identifier | InChI=1/C18H14BrClN2O2/c19-14-4-1-12(2-5-14)18-13(3-10-17(23)24)11-22(21-18)16-8-6-15(20)7-9-16/h1-2, 4-9, 11H, 3, 10H2, (H, 23, 24)/f/h23H InChI key | ZCBWGEKVGZXGBI-UHFFFAOYSA-N

Lewis structure

Draw the Lewis structure of 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds:  Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: n_Br, val + 18 n_C, val + n_Cl, val + 14 n_H, val + 2 n_N, val + 2 n_O, val = 122 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): n_Br, full + 18 n_C, full + n_Cl, full + 14 n_H, full + 2 n_N, full + 2 n_O, full = 220 Subtracting these two numbers shows that 220 - 122 = 98 bonding electrons are needed. Each bond has two electrons, so in addition to the 40 bonds already present in the diagram add 9 bonds. To minimize formal charge carbon wants 4 bonds, nitrogen wants 3 bonds, and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom:  Fill in the 9 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: |   |
Draw the Lewis structure of 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: n_Br, val + 18 n_C, val + n_Cl, val + 14 n_H, val + 2 n_N, val + 2 n_O, val = 122 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): n_Br, full + 18 n_C, full + n_Cl, full + 14 n_H, full + 2 n_N, full + 2 n_O, full = 220 Subtracting these two numbers shows that 220 - 122 = 98 bonding electrons are needed. Each bond has two electrons, so in addition to the 40 bonds already present in the diagram add 9 bonds. To minimize formal charge carbon wants 4 bonds, nitrogen wants 3 bonds, and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 9 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |

Estimated thermodynamic properties

melting point | 428.5 °C boiling point | 757.7 °C critical temperature | 1293 K critical pressure | 2.186 MPa critical volume | 917.5 cm^3/mol molar heat of vaporization | 96.9 kJ/mol molar heat of fusion | 50.43 kJ/mol molar enthalpy | -56.4 kJ/mol molar free energy | 169.6 kJ/mol (computed using the Joback method)
melting point | 428.5 °C boiling point | 757.7 °C critical temperature | 1293 K critical pressure | 2.186 MPa critical volume | 917.5 cm^3/mol molar heat of vaporization | 96.9 kJ/mol molar heat of fusion | 50.43 kJ/mol molar enthalpy | -56.4 kJ/mol molar free energy | 169.6 kJ/mol (computed using the Joback method)

Units

Quantitative molecular descriptors

longest chain length | 13 atoms longest straight chain length | 4 atoms longest aliphatic chain length | 3 atoms aromatic atom count | 17 atoms H-bond acceptor count | 3 atoms H-bond donor count | 1 atom
longest chain length | 13 atoms longest straight chain length | 4 atoms longest aliphatic chain length | 3 atoms aromatic atom count | 17 atoms H-bond acceptor count | 3 atoms H-bond donor count | 1 atom

Elemental composition

Find the elemental composition for 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_18H_14BrClN_2O_2 Use the chemical formula, C_18H_14BrClN_2O_2, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms:  | number of atoms  Br (bromine) | 1  C (carbon) | 18  N (nitrogen) | 2  O (oxygen) | 2  Cl (chlorine) | 1  H (hydrogen) | 14  N_atoms = 1 + 18 + 2 + 2 + 1 + 14 = 38 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work:  | number of atoms | atom fraction  Br (bromine) | 1 | 1/38  C (carbon) | 18 | 18/38  N (nitrogen) | 2 | 2/38  O (oxygen) | 2 | 2/38  Cl (chlorine) | 1 | 1/38  H (hydrogen) | 14 | 14/38 Check: 1/38 + 18/38 + 2/38 + 2/38 + 1/38 + 14/38 = 1 Compute atom percents using the atom fractions:  | number of atoms | atom percent  Br (bromine) | 1 | 1/38 × 100% = 2.63%  C (carbon) | 18 | 18/38 × 100% = 47.4%  N (nitrogen) | 2 | 2/38 × 100% = 5.26%  O (oxygen) | 2 | 2/38 × 100% = 5.26%  Cl (chlorine) | 1 | 1/38 × 100% = 2.63%  H (hydrogen) | 14 | 14/38 × 100% = 36.8% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table:  | number of atoms | atom percent | atomic mass/u  Br (bromine) | 1 | 2.63% | 79.904  C (carbon) | 18 | 47.4% | 12.011  N (nitrogen) | 2 | 5.26% | 14.007  O (oxygen) | 2 | 5.26% | 15.999  Cl (chlorine) | 1 | 2.63% | 35.45  H (hydrogen) | 14 | 36.8% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m:  | number of atoms | atom percent | atomic mass/u | mass/u  Br (bromine) | 1 | 2.63% | 79.904 | 1 × 79.904 = 79.904  C (carbon) | 18 | 47.4% | 12.011 | 18 × 12.011 = 216.198  N (nitrogen) | 2 | 5.26% | 14.007 | 2 × 14.007 = 28.014  O (oxygen) | 2 | 5.26% | 15.999 | 2 × 15.999 = 31.998  Cl (chlorine) | 1 | 2.63% | 35.45 | 1 × 35.45 = 35.45  H (hydrogen) | 14 | 36.8% | 1.008 | 14 × 1.008 = 14.112  m = 79.904 u + 216.198 u + 28.014 u + 31.998 u + 35.45 u + 14.112 u = 405.676 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work:  | number of atoms | atom percent | mass fraction  Br (bromine) | 1 | 2.63% | 79.904/405.676  C (carbon) | 18 | 47.4% | 216.198/405.676  N (nitrogen) | 2 | 5.26% | 28.014/405.676  O (oxygen) | 2 | 5.26% | 31.998/405.676  Cl (chlorine) | 1 | 2.63% | 35.45/405.676  H (hydrogen) | 14 | 36.8% | 14.112/405.676 Check: 79.904/405.676 + 216.198/405.676 + 28.014/405.676 + 31.998/405.676 + 35.45/405.676 + 14.112/405.676 = 1 Compute mass percents using the mass fractions: Answer: |   | | number of atoms | atom percent | mass percent  Br (bromine) | 1 | 2.63% | 79.904/405.676 × 100% = 19.70%  C (carbon) | 18 | 47.4% | 216.198/405.676 × 100% = 53.29%  N (nitrogen) | 2 | 5.26% | 28.014/405.676 × 100% = 6.906%  O (oxygen) | 2 | 5.26% | 31.998/405.676 × 100% = 7.888%  Cl (chlorine) | 1 | 2.63% | 35.45/405.676 × 100% = 8.739%  H (hydrogen) | 14 | 36.8% | 14.112/405.676 × 100% = 3.479%
Find the elemental composition for 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid in terms of the atom and mass percents: atom percent = N_i/N_atoms × 100% mass percent = (N_im_i)/m × 100% Plan: • Write the chemical formula and gather atomic masses from the periodic table. • Determine values for N_i, m_i, N_atoms and m using these items. • Finally, compute the percents and check the results. Write the chemical formula: C_18H_14BrClN_2O_2 Use the chemical formula, C_18H_14BrClN_2O_2, to count the number of atoms, N_i, for each element and find the total number of atoms, N_atoms: | number of atoms Br (bromine) | 1 C (carbon) | 18 N (nitrogen) | 2 O (oxygen) | 2 Cl (chlorine) | 1 H (hydrogen) | 14 N_atoms = 1 + 18 + 2 + 2 + 1 + 14 = 38 Divide each N_i by N_atoms to calculate atom fractions. Then use the property that atom fractions must sum to one to check the work: | number of atoms | atom fraction Br (bromine) | 1 | 1/38 C (carbon) | 18 | 18/38 N (nitrogen) | 2 | 2/38 O (oxygen) | 2 | 2/38 Cl (chlorine) | 1 | 1/38 H (hydrogen) | 14 | 14/38 Check: 1/38 + 18/38 + 2/38 + 2/38 + 1/38 + 14/38 = 1 Compute atom percents using the atom fractions: | number of atoms | atom percent Br (bromine) | 1 | 1/38 × 100% = 2.63% C (carbon) | 18 | 18/38 × 100% = 47.4% N (nitrogen) | 2 | 2/38 × 100% = 5.26% O (oxygen) | 2 | 2/38 × 100% = 5.26% Cl (chlorine) | 1 | 1/38 × 100% = 2.63% H (hydrogen) | 14 | 14/38 × 100% = 36.8% Look up the atomic mass, m_i, in unified atomic mass units, u, for each element in the periodic table: | number of atoms | atom percent | atomic mass/u Br (bromine) | 1 | 2.63% | 79.904 C (carbon) | 18 | 47.4% | 12.011 N (nitrogen) | 2 | 5.26% | 14.007 O (oxygen) | 2 | 5.26% | 15.999 Cl (chlorine) | 1 | 2.63% | 35.45 H (hydrogen) | 14 | 36.8% | 1.008 Multiply N_i by m_i to compute the mass for each element. Then sum those values to compute the molecular mass, m: | number of atoms | atom percent | atomic mass/u | mass/u Br (bromine) | 1 | 2.63% | 79.904 | 1 × 79.904 = 79.904 C (carbon) | 18 | 47.4% | 12.011 | 18 × 12.011 = 216.198 N (nitrogen) | 2 | 5.26% | 14.007 | 2 × 14.007 = 28.014 O (oxygen) | 2 | 5.26% | 15.999 | 2 × 15.999 = 31.998 Cl (chlorine) | 1 | 2.63% | 35.45 | 1 × 35.45 = 35.45 H (hydrogen) | 14 | 36.8% | 1.008 | 14 × 1.008 = 14.112 m = 79.904 u + 216.198 u + 28.014 u + 31.998 u + 35.45 u + 14.112 u = 405.676 u Divide the mass for each element by m to calculate mass fractions. Then use the property that mass fractions must sum to one to check the work: | number of atoms | atom percent | mass fraction Br (bromine) | 1 | 2.63% | 79.904/405.676 C (carbon) | 18 | 47.4% | 216.198/405.676 N (nitrogen) | 2 | 5.26% | 28.014/405.676 O (oxygen) | 2 | 5.26% | 31.998/405.676 Cl (chlorine) | 1 | 2.63% | 35.45/405.676 H (hydrogen) | 14 | 36.8% | 14.112/405.676 Check: 79.904/405.676 + 216.198/405.676 + 28.014/405.676 + 31.998/405.676 + 35.45/405.676 + 14.112/405.676 = 1 Compute mass percents using the mass fractions: Answer: | | | number of atoms | atom percent | mass percent Br (bromine) | 1 | 2.63% | 79.904/405.676 × 100% = 19.70% C (carbon) | 18 | 47.4% | 216.198/405.676 × 100% = 53.29% N (nitrogen) | 2 | 5.26% | 28.014/405.676 × 100% = 6.906% O (oxygen) | 2 | 5.26% | 31.998/405.676 × 100% = 7.888% Cl (chlorine) | 1 | 2.63% | 35.45/405.676 × 100% = 8.739% H (hydrogen) | 14 | 36.8% | 14.112/405.676 × 100% = 3.479%

Elemental oxidation states

The first step in finding the oxidation states (or oxidation numbers) in 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge:  In 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond:  With hydrogen out of the way, look at the remaining bonds. There are 1 bromine-carbon bond, 1 carbon-carbonl bond, 3 carbon-nitrogen bonds, 2 carbon-oxygen bonds, 18 carbon-carbon bonds, and 1 nitrogen-nitrogen bond. For each of these bonds, assign the bonding electrons to the most electronegative element.  First examine the bromine-carbon bond: element | electronegativity (Pauling scale) |  Br | 2.96 |  C | 2.55 |   | |  Since bromine is more electronegative than carbon, the electrons in this bond will go to bromine. Decrease the oxidation number for bromine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly:  Next look at the carbon-carbonl bond: element | electronegativity (Pauling scale) |  C | 2.55 |  Cl | 3.16 |   | |  Since chlorine is more electronegative than carbon, the electrons in this bond will go to chlorine:  Next look at the carbon-nitrogen bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  N | 3.04 |   | |  Since nitrogen is more electronegative than carbon, the electrons in these bonds will go to nitrogen:  Next look at the carbon-oxygen bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  O | 3.44 |   | |  Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen:  Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) |  C | 2.55 |  C | 2.55 |   | |  Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states:  Next look at the nitrogen-nitrogen bond: element | electronegativity (Pauling scale) |  N | 3.04 |  N | 3.04 |   | |  Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states:  Now summarize the results: Answer: |   | oxidation state | element | count  -2 | C (carbon) | 2  | N (nitrogen) | 2  | O (oxygen) | 2  -1 | Br (bromine) | 1  | C (carbon) | 8  | Cl (chlorine) | 1  0 | C (carbon) | 3  +1 | C (carbon) | 3  | H (hydrogen) | 14  +2 | C (carbon) | 1  +3 | C (carbon) | 1
The first step in finding the oxidation states (or oxidation numbers) in 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid is to draw the structure diagram. Next set every oxidation number equal to the atom's formal charge: In 3-(4-bromophenyl)-1-(4-chlorophenyl)pyrazole-4-propionic acid hydrogen is not bonded to a metal with lower electronegativity, so it will have an oxidation state of +1. Any element bonded to hydrogen gains the bonding electrons, decreasing their oxidation state by 1 for every bond: With hydrogen out of the way, look at the remaining bonds. There are 1 bromine-carbon bond, 1 carbon-carbonl bond, 3 carbon-nitrogen bonds, 2 carbon-oxygen bonds, 18 carbon-carbon bonds, and 1 nitrogen-nitrogen bond. For each of these bonds, assign the bonding electrons to the most electronegative element. First examine the bromine-carbon bond: element | electronegativity (Pauling scale) | Br | 2.96 | C | 2.55 | | | Since bromine is more electronegative than carbon, the electrons in this bond will go to bromine. Decrease the oxidation number for bromine (by 1 for single bonds, 2 for double bonds, and 3 for triple bonds), and increase the oxidation number for carbon accordingly: Next look at the carbon-carbonl bond: element | electronegativity (Pauling scale) | C | 2.55 | Cl | 3.16 | | | Since chlorine is more electronegative than carbon, the electrons in this bond will go to chlorine: Next look at the carbon-nitrogen bonds: element | electronegativity (Pauling scale) | C | 2.55 | N | 3.04 | | | Since nitrogen is more electronegative than carbon, the electrons in these bonds will go to nitrogen: Next look at the carbon-oxygen bonds: element | electronegativity (Pauling scale) | C | 2.55 | O | 3.44 | | | Since oxygen is more electronegative than carbon, the electrons in these bonds will go to oxygen: Next look at the carbon-carbon bonds: element | electronegativity (Pauling scale) | C | 2.55 | C | 2.55 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Next look at the nitrogen-nitrogen bond: element | electronegativity (Pauling scale) | N | 3.04 | N | 3.04 | | | Since these elements are the same the bonding electrons are shared equally, and there is no change to the oxidation states: Now summarize the results: Answer: | | oxidation state | element | count -2 | C (carbon) | 2 | N (nitrogen) | 2 | O (oxygen) | 2 -1 | Br (bromine) | 1 | C (carbon) | 8 | Cl (chlorine) | 1 0 | C (carbon) | 3 +1 | C (carbon) | 3 | H (hydrogen) | 14 +2 | C (carbon) | 1 +3 | C (carbon) | 1