beta-D-fructose

beta-D-fructose

formula | C_6H_12O_6 name | beta-D-fructose mass fractions | C (carbon) 40% | H (hydrogen) 6.71% | O (oxygen) 53.3%

Draw the Lewis structure of beta-D-fructose. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 6 n_O, val = 72 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 6 n_O, full = 120 Subtracting these two numbers shows that 120 - 72 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 72 - 48 = 24 electrons left to draw: Answer: | |

molar mass | 180.16 g/mol

SMILES identifier | C([C@@H]1[C@H]([C@@H]([C@](CO)(O)O1)O)O)O