Input interpretation
2-bromooctanoic acid
Chemical names and formulas
formula | CH_3(CH_2)_5CH(Br)COOH Hill formula | C_8H_15BrO_2 name | 2-bromooctanoic acid alternate names | 2-bromocaprylic acid | 2-bromooctanoate | (+-)-2-bromooctanoic acid mass fractions | Br (bromine) 35.8% | C (carbon) 43.1% | H (hydrogen) 6.78% | O (oxygen) 14.3%
Lewis structure
Draw the Lewis structure of 2-bromooctanoic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_Br, val + 8 n_C, val + 15 n_H, val + 2 n_O, val = 66 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_Br, full + 8 n_C, full + 15 n_H, full + 2 n_O, full = 118 Subtracting these two numbers shows that 118 - 66 = 52 bonding electrons are needed. Each bond has two electrons, so in addition to the 25 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 223.11 g/mol phase | liquid (at STP) boiling point | 140 °C (measured at 666.5 Pa) density | 1.278 g/cm^3 solubility in water | very soluble
Units
Liquid properties (at STP)
density | 1.278 g/cm^3 vapor pressure | 0.001 mmHg (at 25 °C) refractive index | 1.471
Units
Thermodynamic properties
molar heat of vaporization | 57.3 kJ/mol specific heat of vaporization | 0.257 kJ/g (at STP)
Chemical identifiers
CAS number | 2623-82-7 Beilstein number | 1760958 PubChem CID number | 552003 PubChem SID number | 24856942 SMILES identifier | CCCCCCC(C(=O)O)Br InChI identifier | InChI=1/C8H15BrO2/c1-2-3-4-5-6-7(9)8(10)11/h7H, 2-6H2, 1H3, (H, 10, 11)/f/h10H MDL number | MFCD00004219
NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 1 NFPA reactivity rating | 0
Safety properties
flash point | 110 °C
DOT hazard class | 8 DOT numbers | 3265