Search

InChI identifier (2, 4, 6-trimethylpyridine)

Input interpretation

2, 4, 6-collidine | InChI identifier
2, 4, 6-collidine | InChI identifier

Result

InChI=1/C8H11N/c1-6-4-7(2)9-8(3)5-6/h4-5H, 1-3H3
InChI=1/C8H11N/c1-6-4-7(2)9-8(3)5-6/h4-5H, 1-3H3

Random Queries

molar radioactivities of alkali metals
melting point of palladium oxide
formula of gallium(I) cation vs boron(II) cation
structure diagram of gallium(I) cation
name of bromide anion
melting point of pearl ash vs ammonium hydroxide
ion class of nitrate anion
NaBr = Br2 + Na
formulas of molybdenum(III) ions
superconducting point of tantalum