Input interpretation
![1, 1-diphenylethylene](../image_source/83b02a66788820564dd79c7e2105595f.png)
1, 1-diphenylethylene
Chemical names and formulas
![formula | (C_6H_5)_2C=CH_2 Hill formula | C_14H_12 name | 1, 1-diphenylethylene IUPAC name | 1-phenylvinylbenzene alternate names | 1, 1-diphenylethene | 1-phenylethenylbenzene | 1-phenylvinylbenzene | benzene, 1, 1'-ethenylidenebis | benzene, 1, 1'-ethenylidenebis- | ethylene, 1, 1-diphenyl- | unsym-diphenylethylene mass fractions | C (carbon) 93.3% | H (hydrogen) 6.71%](../image_source/070448ef735730d1965996a73eebf84f.png)
formula | (C_6H_5)_2C=CH_2 Hill formula | C_14H_12 name | 1, 1-diphenylethylene IUPAC name | 1-phenylvinylbenzene alternate names | 1, 1-diphenylethene | 1-phenylethenylbenzene | 1-phenylvinylbenzene | benzene, 1, 1'-ethenylidenebis | benzene, 1, 1'-ethenylidenebis- | ethylene, 1, 1-diphenyl- | unsym-diphenylethylene mass fractions | C (carbon) 93.3% | H (hydrogen) 6.71%
Lewis structure
![Draw the Lewis structure of 1, 1-diphenylethylene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 14 n_C, val + 12 n_H, val = 68 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 14 n_C, full + 12 n_H, full = 136 Subtracting these two numbers shows that 136 - 68 = 68 bonding electrons are needed. Each bond has two electrons, so in addition to the 27 bonds already present in the diagram add 7 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |](../image_source/5788e465cd774e29b2e33a22833c4ec9.png)
Draw the Lewis structure of 1, 1-diphenylethylene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 14 n_C, val + 12 n_H, val = 68 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 14 n_C, full + 12 n_H, full = 136 Subtracting these two numbers shows that 136 - 68 = 68 bonding electrons are needed. Each bond has two electrons, so in addition to the 27 bonds already present in the diagram add 7 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
![3D structure](../image_source/a7e20c80bc209172105af4eb57306c6c.png)
3D structure
Basic properties
![molar mass | 180.25 g/mol phase | liquid (at STP) melting point | 6 °C boiling point | 270.5 °C density | 1.021 g/cm^3 solubility in water | insoluble](../image_source/2adc58a0cfc09fac13e2ed51dcd44b6c.png)
molar mass | 180.25 g/mol phase | liquid (at STP) melting point | 6 °C boiling point | 270.5 °C density | 1.021 g/cm^3 solubility in water | insoluble
Units
Liquid properties (at STP)
![density | 1.021 g/cm^3 vapor pressure | 0.0078 mmHg (at 25 °C) dynamic viscosity | 0.0202 Pa s (at 0 °C) refractive index | 1.608](../image_source/51c61510d0829679ba8b504c24e2bcfc.png)
density | 1.021 g/cm^3 vapor pressure | 0.0078 mmHg (at 25 °C) dynamic viscosity | 0.0202 Pa s (at 0 °C) refractive index | 1.608
Units
Thermodynamic properties
![molar heat of vaporization | 73.4 kJ/mol specific heat of vaporization | 0.407 kJ/g (at STP)](../image_source/002336120501a1846c318df57487132b.png)
molar heat of vaporization | 73.4 kJ/mol specific heat of vaporization | 0.407 kJ/g (at STP)
Chemical identifiers
![CAS number | 530-48-3 Beilstein number | 1099062 PubChem CID number | 10740 PubChem SID number | 24893616 SMILES identifier | C=C(C1=CC=CC=C1)C2=CC=CC=C2 InChI identifier | InChI=1/C14H12/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H, 1H2 MDL number | MFCD00008583](../image_source/408e668a234f3986cf089d44ca50ba4c.png)
CAS number | 530-48-3 Beilstein number | 1099062 PubChem CID number | 10740 PubChem SID number | 24893616 SMILES identifier | C=C(C1=CC=CC=C1)C2=CC=CC=C2 InChI identifier | InChI=1/C14H12/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H, 1H2 MDL number | MFCD00008583
Safety properties
![flash point | 110 °C](../image_source/a9a7a75b9ca73d6a087867b4501e620c.png)
flash point | 110 °C