Search

SMILES identifier of 2,4'-dibromopropiophenone vs 5,6-dimethoxyindan-1-one

Input interpretation

2, 4'-dibromopropiophenone 5, 6-dimethoxyindan-1-one | SMILES identifier
2, 4'-dibromopropiophenone 5, 6-dimethoxyindan-1-one | SMILES identifier

Results

2, 4'-dibromopropiophenone | CC(C(=O)C1=CC=C(C=C1)Br)Br 5, 6-dimethoxyindan-1-one | COC1=C(C=C2C(=C1)CCC2=O)OC
2, 4'-dibromopropiophenone | CC(C(=O)C1=CC=C(C=C1)Br)Br 5, 6-dimethoxyindan-1-one | COC1=C(C=C2C(=C1)CCC2=O)OC

Random Queries

melting point of xenon vs indium
space group of zirconium
iodine vs chlorine vs bromine
member of solid
atomic radius of fluorine vs nitrogen
IUPAC name of tetrairidium dodecacarbonyl vs 2-cyanophenylboronic acid pinacol ester
chemical types of nitrogen vs 1,2-difluoroethane
radon(II) cation vs xenon(VIII) cation
CAS number of potassium ferrate(VI)
molar mass of cerium(III) tungstate