Search

tetraphenylethylene vs geranyl bromide

Input interpretation

tetraphenylethylene | geranyl bromide
tetraphenylethylene | geranyl bromide

Chemical names and formulas

 | tetraphenylethylene | geranyl bromide formula | (C_6H_5)_2C=C(C_6H_5)_2 | (CH_3)_2C=CHCH_2CH_2C(CH_3)=CHCH_2Br Hill formula | C_26H_20 | C_10H_17Br name | tetraphenylethylene | geranyl bromide IUPAC name | 1, 2, 2-tri(phenyl)vinylbenzene | (2E)-1-bromo-3, 7-dimethylocta-2, 6-diene alternate names | 1, 1, 2, 2-tetraphenylethene | 1, 1, 2, 2-tetraphenylethylene | 1, 2, 2-tri(phenyl)ethenylbenzene | 1, 2, 2-tri(phenyl)vinylbenzene | benzene, 1, 1', 1'', 1'''-(1, 2-ethenediylidene)tetrakis- | ethylene, tetraphenyl- | 2, 6-octadiene, 1-bromo-3, 7-dimethyl-, (2E)- | 2, 6-octadiene, 1-bromo-3, 7-dimethyl-, (E)- | (2E)-1-bromo-3, 7-dimethyl-2, 6-octadiene | (2E)-1-bromo-3, 7-dimethyl-octa-2, 6-diene | (2E)-1-bromo-3, 7-dimethylocta-2, 6-diene | (E)-1-bromo-3, 7-dimethylocta-2, 6-diene | trans-1-bromo-3, 7-dimethyl-2, 6-octadiene mass fractions | C (carbon) 93.9% | H (hydrogen) 6.06% | Br (bromine) 36.8% | C (carbon) 55.3% | H (hydrogen) 7.89%
| tetraphenylethylene | geranyl bromide formula | (C_6H_5)_2C=C(C_6H_5)_2 | (CH_3)_2C=CHCH_2CH_2C(CH_3)=CHCH_2Br Hill formula | C_26H_20 | C_10H_17Br name | tetraphenylethylene | geranyl bromide IUPAC name | 1, 2, 2-tri(phenyl)vinylbenzene | (2E)-1-bromo-3, 7-dimethylocta-2, 6-diene alternate names | 1, 1, 2, 2-tetraphenylethene | 1, 1, 2, 2-tetraphenylethylene | 1, 2, 2-tri(phenyl)ethenylbenzene | 1, 2, 2-tri(phenyl)vinylbenzene | benzene, 1, 1', 1'', 1'''-(1, 2-ethenediylidene)tetrakis- | ethylene, tetraphenyl- | 2, 6-octadiene, 1-bromo-3, 7-dimethyl-, (2E)- | 2, 6-octadiene, 1-bromo-3, 7-dimethyl-, (E)- | (2E)-1-bromo-3, 7-dimethyl-2, 6-octadiene | (2E)-1-bromo-3, 7-dimethyl-octa-2, 6-diene | (2E)-1-bromo-3, 7-dimethylocta-2, 6-diene | (E)-1-bromo-3, 7-dimethylocta-2, 6-diene | trans-1-bromo-3, 7-dimethyl-2, 6-octadiene mass fractions | C (carbon) 93.9% | H (hydrogen) 6.06% | Br (bromine) 36.8% | C (carbon) 55.3% | H (hydrogen) 7.89%

Structure diagrams

  | tetraphenylethylene | geranyl bromide vertex count | 26 | 11 edge count | 29 | 10 Schultz index | 6536 | 708 Wiener index | 1477 | 194 Hosoya index | 479520 | 109 Balaban index | 1.589 | 3.1
| tetraphenylethylene | geranyl bromide vertex count | 26 | 11 edge count | 29 | 10 Schultz index | 6536 | 708 Wiener index | 1477 | 194 Hosoya index | 479520 | 109 Balaban index | 1.589 | 3.1

3D structure

3D structure
3D structure

Basic properties

 | tetraphenylethylene | geranyl bromide molar mass | 332.45 g/mol | 217.15 g/mol phase | solid (at STP) | liquid (at STP) melting point | 223 °C |  boiling point | 420 °C | 101.5 °C density | 1.148 g/cm^3 | 1.094 g/cm^3 solubility in water | insoluble |
| tetraphenylethylene | geranyl bromide molar mass | 332.45 g/mol | 217.15 g/mol phase | solid (at STP) | liquid (at STP) melting point | 223 °C | boiling point | 420 °C | 101.5 °C density | 1.148 g/cm^3 | 1.094 g/cm^3 solubility in water | insoluble |

Units

Liquid properties

 | geranyl bromide density | 1.094 g/cm^3 refractive index | 1.504
| geranyl bromide density | 1.094 g/cm^3 refractive index | 1.504

Units

Thermodynamic properties

 | tetraphenylethylene molar heat of vaporization | 64.8 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.195 kJ/g (kilojoules per gram)
| tetraphenylethylene molar heat of vaporization | 64.8 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.195 kJ/g (kilojoules per gram)

Solid properties

 | tetraphenylethylene density | 1.148 g/cm^3 vapor pressure | 7×10^-7 mmHg
| tetraphenylethylene density | 1.148 g/cm^3 vapor pressure | 7×10^-7 mmHg

Units

Chemical identifiers

 | tetraphenylethylene | geranyl bromide CAS number | 632-51-9 | 6138-90-5 Beilstein number | 1913548 | 1703631 PubChem CID number | 69437 | 5365867 PubChem SID number | 24900047 | 24859770 SMILES identifier | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 | CC(=CCCC(=CCBr)C)C
| tetraphenylethylene | geranyl bromide CAS number | 632-51-9 | 6138-90-5 Beilstein number | 1913548 | 1703631 PubChem CID number | 69437 | 5365867 PubChem SID number | 24900047 | 24859770 SMILES identifier | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 | CC(=CCCC(=CCBr)C)C

NFPA label

NFPA label
NFPA label

Safety properties

 | tetraphenylethylene | geranyl bromide flash point | 206 °C | 95 °C
| tetraphenylethylene | geranyl bromide flash point | 206 °C | 95 °C