Search

handwritten style soda ash

Input interpretation

soda ash
soda ash

Chemical names and formulas

formula | Na_2CO_3 Hill formula | CNa_2O_3 name | soda ash IUPAC name | disodium carbonate alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3%
formula | Na_2CO_3 Hill formula | CNa_2O_3 name | soda ash IUPAC name | disodium carbonate alternate names | crystol carbonate | disodium carbonate | soda | sodium carbonate mass fractions | C (carbon) 11.3% | Na (sodium) 43.4% | O (oxygen) 45.3%

Structure diagram

Structure diagram
Structure diagram
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 6 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 105.99 g/mol phase | solid (at STP) melting point | 851 °C boiling point | 1600 °C solubility in water | soluble
molar mass | 105.99 g/mol phase | solid (at STP) melting point | 851 °C boiling point | 1600 °C solubility in water | soluble

Units

Solid properties (at STP)

refractive index | 1.495
refractive index | 1.495

Thermodynamic properties

specific heat capacity c_p | solid | 1.06 J/(g K) molar heat capacity c_p | solid | 112.3 J/(mol K) specific free energy of formation Δ_fG° | solid | -9.854 kJ/g molar free energy of formation Δ_fG° | solid | -1044 kJ/mol specific heat of formation Δ_fH° | solid | -10.67 kJ/g molar heat of formation Δ_fH° | solid | -1131 kJ/mol specific entropy S° | solid | 1.283 J/(g K) molar entropy S° | solid | 136 J/(mol K) molar heat of fusion | 29.7 kJ/mol | specific heat of fusion | 0.28 kJ/g | (at STP)
specific heat capacity c_p | solid | 1.06 J/(g K) molar heat capacity c_p | solid | 112.3 J/(mol K) specific free energy of formation Δ_fG° | solid | -9.854 kJ/g molar free energy of formation Δ_fG° | solid | -1044 kJ/mol specific heat of formation Δ_fH° | solid | -10.67 kJ/g molar heat of formation Δ_fH° | solid | -1131 kJ/mol specific entropy S° | solid | 1.283 J/(g K) molar entropy S° | solid | 136 J/(mol K) molar heat of fusion | 29.7 kJ/mol | specific heat of fusion | 0.28 kJ/g | (at STP)

Chemical identifiers

CAS number | 497-19-8 Beilstein number | 4154566 PubChem CID number | 10340 PubChem SID number | 24852265 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m RTECS number | VZ4050000 MDL number | MFCD00003494
CAS number | 497-19-8 Beilstein number | 4154566 PubChem CID number | 10340 PubChem SID number | 24852265 SMILES identifier | C(=O)([O-])[O-].[Na+].[Na+] InChI identifier | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2, 2, 3, 4);;/q;2*+1/p-2/fCO3.2Na/q-2;2m RTECS number | VZ4050000 MDL number | MFCD00003494

NFPA label

NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

RTECS classes | agricultural chemical and pesticide | mutagen | reproductive effector | human data | primary irritant
RTECS classes | agricultural chemical and pesticide | mutagen | reproductive effector | human data | primary irritant

Ion equivalents

Na^+ (sodium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1
Na^+ (sodium cation) | 2 (CO_3)^(2-) (carbonate anion) | 1

Random Queries

name of 3-methylbenzylmagnesium chloride
Hill formula of cesium methanesulfonate
MnCl2 + Pb = PbCl2 + Mn
element types of 2-ethylhexyl acrylate
how would a dog see andradite image
molar mass of praseodymium oxide vs neodymium(III) sulfate hydrate
molar mass of 1,3,5-trimethyl-1,1,3,5,5-pentaphenyltrisiloxane vs 2-methylaminopyridine
work function of palladium vs rhodium
nitrogen trifluoride
formula of phosphate anion vs hydroxide anion