name of fluorotryptophane

fluorotryptophane

formula | C_11H_11FN_2O_2 name | fluorotryptophane IUPAC name | (2S)-2-amino-3-(5-fluoro-1H-indol-3-yl)propanoic acid mass fractions | C (carbon) 59.5% | F (fluorine) 8.55% | H (hydrogen) 4.99% | N (nitrogen) 12.6% | O (oxygen) 14.4%

Draw the Lewis structure of fluorotryptophane. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 11 n_C, val + n_F, val + 11 n_H, val + 2 n_N, val + 2 n_O, val = 84 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 11 n_C, full + n_F, full + 11 n_H, full + 2 n_N, full + 2 n_O, full = 150 Subtracting these two numbers shows that 150 - 84 = 66 bonding electrons are needed. Each bond has two electrons, so in addition to the 28 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 222.22 g/mol phase | solid (at STP)

predicted LogP hydrophobicity | -1.01 predicted LogS | -2.26

approval status | experimental | small molecule

CAS number | 16626-02-1 PubChem CID number | 688357 PubChem SID number | 16046265 SMILES identifier | C1=CC2=C(C=C1F)C(=CN2)CC(C(=O)O)N InChI identifier | InChI=1/C11H11FN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2, 4-5, 9, 14H, 3, 13H2, (H, 15, 16)/t9-/m0/s1/f/h15H InChI key | INPQIVHQSQUEAJ-GTNTULIADJ