Search

name of tungstic acid vs desacetoxyvindoline

Input interpretation

tungstic acid | desacetoxyvindoline
tungstic acid | desacetoxyvindoline

Chemical names and formulas

 | tungstic acid | desacetoxyvindoline formula | H_2WO_4 | C_23H_30N_2O_4 Hill formula | H_2O_4W | C_23H_30N_2O_4 name | tungstic acid | desacetoxyvindoline IUPAC name | dihydroxy-dioxotungsten |  alternate names | dihydroxy-diketo-tungsten | dihydroxy-dioxo-tungsten | dihydroxy-dioxotungsten | orthotungstic acid | tungstic(VI) acid | tunstic acid | wolframic acid | deacetoxyvindoline mass fractions | H (hydrogen) 0.807% | O (oxygen) 25.6% | W (tungsten) 73.6% | C (carbon) 69.3% | H (hydrogen) 7.59% | N (nitrogen) 7.03% | O (oxygen) 16.1%
| tungstic acid | desacetoxyvindoline formula | H_2WO_4 | C_23H_30N_2O_4 Hill formula | H_2O_4W | C_23H_30N_2O_4 name | tungstic acid | desacetoxyvindoline IUPAC name | dihydroxy-dioxotungsten | alternate names | dihydroxy-diketo-tungsten | dihydroxy-dioxo-tungsten | dihydroxy-dioxotungsten | orthotungstic acid | tungstic(VI) acid | tunstic acid | wolframic acid | deacetoxyvindoline mass fractions | H (hydrogen) 0.807% | O (oxygen) 25.6% | W (tungsten) 73.6% | C (carbon) 69.3% | H (hydrogen) 7.59% | N (nitrogen) 7.03% | O (oxygen) 16.1%

Structure diagrams

  | tungstic acid | desacetoxyvindoline vertex count | 5 | 29 edge count | 6 | 34 Schultz index | 64 | 7572 Wiener index | 16 | 1730 Hosoya index | 5 | 1.345×10^6 Balaban index | 3.024 | 1.678
| tungstic acid | desacetoxyvindoline vertex count | 5 | 29 edge count | 6 | 34 Schultz index | 64 | 7572 Wiener index | 16 | 1730 Hosoya index | 5 | 1.345×10^6 Balaban index | 3.024 | 1.678

Basic properties

 | tungstic acid | desacetoxyvindoline molar mass | 249.85 g/mol | 398.5 g/mol density | 5.5 g/cm^3 |
| tungstic acid | desacetoxyvindoline molar mass | 249.85 g/mol | 398.5 g/mol density | 5.5 g/cm^3 |

Units

Chemical identifiers

 | tungstic acid | desacetoxyvindoline CAS number | 7783-03-1 |  PubChem CID number | 1152 | 25203293 PubChem SID number | 24853375 |  SMILES identifier | O[W](=O)(=O)O | CCC15(C4(C2(C(C(C(OC)=O)(C1)O)N(C3(=C2C=CC(OC)=C3))C)CC[N+]4CC=C5))
| tungstic acid | desacetoxyvindoline CAS number | 7783-03-1 | PubChem CID number | 1152 | 25203293 PubChem SID number | 24853375 | SMILES identifier | O[W](=O)(=O)O | CCC15(C4(C2(C(C(C(OC)=O)(C1)O)N(C3(=C2C=CC(OC)=C3))C)CC[N+]4CC=C5))