Search

chrysotile vs xylarohydroxamate

Input interpretation

chrysotile | xylarohydroxamate
chrysotile | xylarohydroxamate

Chemical names and formulas

 | chrysotile | xylarohydroxamate formula | H_4Mg_3O_9Si_2 | C_5H_8NO_7 Hill formula | H_4Mg_3O_9Si_2 | C_5H_8NO_7 name | chrysotile | xylarohydroxamate IUPAC name | trimagnesium hydroxy-trioxido-silane hydrate | (2R, 3S, 4S)-2, 3, 4-trihydroxy-5-(hydroxyamino)-5-oxopentanoate alternate names | asbestos, serpentine | serpentine chrysotile | white asbestos | (none) mass fractions | H (hydrogen) 1.46% | Mg (magnesium) 26.3% | O (oxygen) 52% | Si (silicon) 20.3% | C (carbon) 30.9% | H (hydrogen) 4.15% | N (nitrogen) 7.22% | O (oxygen) 57.7%
| chrysotile | xylarohydroxamate formula | H_4Mg_3O_9Si_2 | C_5H_8NO_7 Hill formula | H_4Mg_3O_9Si_2 | C_5H_8NO_7 name | chrysotile | xylarohydroxamate IUPAC name | trimagnesium hydroxy-trioxido-silane hydrate | (2R, 3S, 4S)-2, 3, 4-trihydroxy-5-(hydroxyamino)-5-oxopentanoate alternate names | asbestos, serpentine | serpentine chrysotile | white asbestos | (none) mass fractions | H (hydrogen) 1.46% | Mg (magnesium) 26.3% | O (oxygen) 52% | Si (silicon) 20.3% | C (carbon) 30.9% | H (hydrogen) 4.15% | N (nitrogen) 7.22% | O (oxygen) 57.7%

Structure diagrams

Structure diagrams
Structure diagrams

3D structure

3D structure
3D structure

Basic properties

 | chrysotile | xylarohydroxamate molar mass | 277.11 g/mol | 194.12 g/mol phase | | solid (at STP) density | 2.55 g/cm^3 |  solubility in water | insoluble |
| chrysotile | xylarohydroxamate molar mass | 277.11 g/mol | 194.12 g/mol phase | | solid (at STP) density | 2.55 g/cm^3 | solubility in water | insoluble |

Units

Hydrophobicity and permeability properties

 | xylarohydroxamate predicted LogP hydrophobicity | -2.28 predicted LogS | -0.23
| xylarohydroxamate predicted LogP hydrophobicity | -2.28 predicted LogS | -0.23

Chemical identifiers

 | chrysotile | xylarohydroxamate CAS number | 12001-29-5 |  PubChem CID number | 25477 | 5289593 PubChem SID number | | 7891163 SMILES identifier | O.O[Si]([O-])([O-])[O-].O[Si]([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2] | C(C(C(=O)NO)O)(C(C(=O)[O-])O)O InChI identifier | InChI=1/3Mg.2HO4Si.H2O/c;;;2*1-5(2, 3)4;/h;;;2*1H;1H2/q3*+2;2*-3; | InChI=1/C5H9NO7/c7-1(3(9)5(11)12)2(8)4(10)6-13/h1-3, 7-9, 13H, (H, 6, 10)(H, 11, 12)/p-1/fC5H8NO7/h6H/q-1 InChI key | | DMGBHBFPSRKPBV-UZVBZYAICF Gmelin number | 166724 |  RTECS number | CI6478500 |
| chrysotile | xylarohydroxamate CAS number | 12001-29-5 | PubChem CID number | 25477 | 5289593 PubChem SID number | | 7891163 SMILES identifier | O.O[Si]([O-])([O-])[O-].O[Si]([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2] | C(C(C(=O)NO)O)(C(C(=O)[O-])O)O InChI identifier | InChI=1/3Mg.2HO4Si.H2O/c;;;2*1-5(2, 3)4;/h;;;2*1H;1H2/q3*+2;2*-3; | InChI=1/C5H9NO7/c7-1(3(9)5(11)12)2(8)4(10)6-13/h1-3, 7-9, 13H, (H, 6, 10)(H, 11, 12)/p-1/fC5H8NO7/h6H/q-1 InChI key | | DMGBHBFPSRKPBV-UZVBZYAICF Gmelin number | 166724 | RTECS number | CI6478500 |