Input interpretation
3, 5-diiodoanthranilic acid
Chemical names and formulas
formula | I_2C_6H_2(NH_2)CO_2H Hill formula | C_7H_5I_2NO_2 name | 3, 5-diiodoanthranilic acid IUPAC name | 2-amino-3, 5-diiodobenzoic acid alternate names | 2-amino-3, 5-diiodo-benzoic acid | 2-amino-3, 5-diiodobenzoic acid | anthranilic acid, 3, 5-diiodo- | benzoic acid, 2-amino-3, 5-diiodo- mass fractions | C (carbon) 21.6% | H (hydrogen) 1.3% | I (iodine) 65.3% | N (nitrogen) 3.6% | O (oxygen) 8.23%
Lewis structure
Draw the Lewis structure of 3, 5-diiodoanthranilic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), iodine (n_I, val = 7), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 7 n_C, val + 5 n_H, val + 2 n_I, val + n_N, val + 2 n_O, val = 64 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), iodine (n_I, full = 8), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 7 n_C, full + 5 n_H, full + 2 n_I, full + n_N, full + 2 n_O, full = 106 Subtracting these two numbers shows that 106 - 64 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 17 bonds already present in the diagram add 4 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 4 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 388.93 g/mol phase | solid (at STP) melting point | 242 °C boiling point | 410 °C solubility in water | insoluble
Units
Chemical identifiers
CAS number | 609-86-9 PubChem CID number | 69116 PubChem SID number | 24857108 SMILES identifier | C1=C(C=C(C(=C1I)N)C(=O)O)I InChI identifier | InChI=1/C7H5I2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H, 10H2, (H, 11, 12)/f/h11H RTECS number | CB2999300 MDL number | MFCD00007682
Toxicity properties
RTECS classes | drug