Search

name of hydrogen hexabromoplatinate(IV) hydrate

Input interpretation

hydrogen hexabromoplatinate(IV) hydrate
hydrogen hexabromoplatinate(IV) hydrate

Chemical names and formulas

formula | H_2PtBr_6·xH_2O Hill formula | Br_6H_2Pt name | hydrogen hexabromoplatinate(IV) hydrate IUPAC name | hexabromoplatinum; hydron alternate names | bromoplatinic acid | hexabromoplatinum; hydron | platinic bromide mass fractions | Br (bromine) 70.9% | H (hydrogen) 0.298% | Pt (platinum) 28.8%
formula | H_2PtBr_6·xH_2O Hill formula | Br_6H_2Pt name | hydrogen hexabromoplatinate(IV) hydrate IUPAC name | hexabromoplatinum; hydron alternate names | bromoplatinic acid | hexabromoplatinum; hydron | platinic bromide mass fractions | Br (bromine) 70.9% | H (hydrogen) 0.298% | Pt (platinum) 28.8%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 6 Schultz index | 144 Wiener index | 36 Hosoya index | 7 Balaban index | 4.431
vertex count | 7 edge count | 6 Schultz index | 144 Wiener index | 36 Hosoya index | 7 Balaban index | 4.431

Basic properties

molar mass | 676.52 g/mol
molar mass | 676.52 g/mol

Units

Chemical identifiers

CAS number | 207386-85-4 PubChem CID number | 16212537 PubChem SID number | 24864742 SMILES identifier | [H+].[H+].Br[Pt-2](Br)(Br)(Br)(Br)Br InChI identifier | InChI=1/6BrH.Pt/h6*1H;/q;;;;;;+4/p-4/f6Br.Pt.2H/h6*1h;;;/q6*-1;m;2*+1/rBr6Pt/c1-7(2, 3, 4, 5)6/q-2/p+2/fBr6Pt.2H/qm;2*+1 MDL number | MFCD00150385
CAS number | 207386-85-4 PubChem CID number | 16212537 PubChem SID number | 24864742 SMILES identifier | [H+].[H+].Br[Pt-2](Br)(Br)(Br)(Br)Br InChI identifier | InChI=1/6BrH.Pt/h6*1H;/q;;;;;;+4/p-4/f6Br.Pt.2H/h6*1h;;;/q6*-1;m;2*+1/rBr6Pt/c1-7(2, 3, 4, 5)6/q-2/p+2/fBr6Pt.2H/qm;2*+1 MDL number | MFCD00150385