Search

name of copper(II) oxalate

Input interpretation

copper(II) oxalate
copper(II) oxalate

Chemical names and formulas

formula | CuC_2O_4 Hill formula | C_2CuO_4 name | copper(II) oxalate IUPAC name | copper oxalate alternate names | copper oxalate | copper ethanedioate | cupric oxalate mass fractions | C (carbon) 15.8% | Cu (copper) 41.9% | O (oxygen) 42.2%
formula | CuC_2O_4 Hill formula | C_2CuO_4 name | copper(II) oxalate IUPAC name | copper oxalate alternate names | copper oxalate | copper ethanedioate | cupric oxalate mass fractions | C (carbon) 15.8% | Cu (copper) 41.9% | O (oxygen) 42.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993
vertex count | 7 edge count | 5 Schultz index | 108 Wiener index | 29 Hosoya index | 10 Balaban index | 2.993

Basic properties

molar mass | 151.56 g/mol
molar mass | 151.56 g/mol

Units

Chemical identifiers

CAS number | 814-91-5 PubChem CID number | 13148 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cu+2] InChI identifier | InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m
CAS number | 814-91-5 PubChem CID number | 13148 SMILES identifier | C(=O)(C(=O)[O-])[O-].[Cu+2] InChI identifier | InChI=1/C2H2O4.Cu/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cu/q-2;m

Ion equivalents

Cu^(2+) (copper(II) cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1
Cu^(2+) (copper(II) cation) | 1 (C_2O_4)^(2-) (oxalate anion) | 1

Random Queries

formula of lithide(1-) anion
SMILES identifier of polar protic solvents
molar mass of manganese(II) bromide
DOT numbers of magnesium perchlorate
chemical types of samarium(III) carbonate hydrate vs sodium percarbonate
freezing point of cyclohexane, 1,1'-(1,5-pentanediyl)bis-
melting point of ammonium metatungstate hydrate
silicon vs germanium vs praseodymium vs dysprosium
name of ascorbic acid
decay products of Cl-40