Search

name of tetrapropylammonium perruthenate

Input interpretation

tetrapropylammonium perruthenate
tetrapropylammonium perruthenate

Chemical names and formulas

formula | (CH_3CH_2CH_2)_4NRuO_4 Hill formula | C_12H_28NO_4Ru name | tetrapropylammonium perruthenate alternate names | TPAP mass fractions | C (carbon) 41% | H (hydrogen) 8.03% | N (nitrogen) 3.99% | O (oxygen) 18.2% | Ru (ruthenium) 28.8%
formula | (CH_3CH_2CH_2)_4NRuO_4 Hill formula | C_12H_28NO_4Ru name | tetrapropylammonium perruthenate alternate names | TPAP mass fractions | C (carbon) 41% | H (hydrogen) 8.03% | N (nitrogen) 3.99% | O (oxygen) 18.2% | Ru (ruthenium) 28.8%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 351.43 g/mol melting point | 160 °C
molar mass | 351.43 g/mol melting point | 160 °C

Units

Chemical identifiers

CAS number | 114615-82-6 PubChem SID number | 24859883 SMILES identifier | CCC[N+](CCC)(CCC)CCC.O=[Ru](=O)(=O)[O-] MDL number | MFCD00074914
CAS number | 114615-82-6 PubChem SID number | 24859883 SMILES identifier | CCC[N+](CCC)(CCC)CCC.O=[Ru](=O)(=O)[O-] MDL number | MFCD00074914

Random Queries

molar mass of 4-fluoro-1-naphthoic acid
non-standard isotope tally of isopropyl alcohol
formula of cesium tribromide vs 2,4-dibromo-6-fluorophenyl isocyanate
Br2 + P = PBr5
molar mass of 9-phenanthrylmagnesium bromide
chemical types of tungsten(IV) chloride vs strontium fluoride
boiling point of nitrous oxide vs germane
formula of manganese(II) chloride vs lead(II) hypophosphite
Cl2 + CH3Cl = HCl + CH2Cl2
H2O + N2O3 = HNO2