Search

aluminum dodecaboride

Input interpretation

aluminum dodecaboride
aluminum dodecaboride

Chemical names and formulas

formula | AlB_12 name | aluminum dodecaboride mass fractions | Al (aluminum) 17.2% | B (boron) 82.8%
formula | AlB_12 name | aluminum dodecaboride mass fractions | Al (aluminum) 17.2% | B (boron) 82.8%

Structure diagram

Structure diagram
Structure diagram
vertex count | 13 edge count | 12 Schultz index | 912 Wiener index | 216 Hosoya index | 322 Balaban index | 2
vertex count | 13 edge count | 12 Schultz index | 912 Wiener index | 216 Hosoya index | 322 Balaban index | 2

Basic properties

molar mass | 156.7 g/mol
molar mass | 156.7 g/mol

Units

Chemical identifiers

CAS number | 12041-54-2 PubChem CID number | 16212552 PubChem SID number | 24864828 SMILES identifier | B1=BB=BB=BB=BB=BB=B1.[Al] InChI identifier | InChI=1/Al.B12/c;1-2-4-6-8-10-12-11-9-7-5-3-1 MDL number | MFCD00084716
CAS number | 12041-54-2 PubChem CID number | 16212552 PubChem SID number | 24864828 SMILES identifier | B1=BB=BB=BB=BB=BB=B1.[Al] InChI identifier | InChI=1/Al.B12/c;1-2-4-6-8-10-12-11-9-7-5-3-1 MDL number | MFCD00084716

Random Queries

ion class of tetrachloroborate anion vs hexabromotellurate(IV) anion
alternate names of norethindrone vs 1-(trimethylsilyl)-1-propyne
chemical types of rubidium
discovery year selenium
colorize components image iridium
formula string of 2,3,7,8,12,13,17,18-octaethyl-21H,23 H-porphine cobalt(II)
Er-164 vs Md-246
cleavage of armangite
HCIO3 = H2O + CIO2 + HCIO4
(freezing point of pearl ash)/(melting point of pearl ash)